C20H12Cl4N4O3 — CID 6161327
2-N,5-N-bis[(Z)-(2,6-dichlorophenyl)methylideneamino]furan-2,5-dicarboxamide (PubChem CID 6161327) has the molecular formula C20H12Cl4N4O3 and a molecular weight of 498.15 g/mol. Its IUPAC name is 2-N,5-N-bis[(Z)-(2,6-dichlorophenyl)methylideneamino]furan-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(Z)-(2,6-dichlorophenyl)methylideneamino]furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 6161327 |
| Molecular Formula | C20H12Cl4N4O3 |
| Molecular Weight | 498.15 g/mol |
| Exact Mass | 495.97 |
| IUPAC Name | 2-N,5-N-bis[(Z)-(2,6-dichlorophenyl)methylideneamino]furan-2,5-dicarboxamide |
| SMILES | O=C(N/N=C\c1c(Cl)cccc1Cl)c1ccc(C(=O)N/N=C\c2c(Cl)cccc2Cl)o1 |
| InChI | InChI=1S/C20H12Cl4N4O3/c21-13-3-1-4-14(22)11(13)9-25-27-19(29)17-7-8-18(31-17)20(30)28-26-10-12-15(23)5-2-6-16(12)24/h1-10H,(H,27,29)(H,28,30)/b25-9-,26-10- |
| InChIKey | ZLFYNJUBRYIVHX-UMOSFCNPSA-N |
| XLogP | 5.42 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.15 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|