C12H16N6S2 — CID 6903322
1-methyl-3-[(E)-[3-[(E)-(methylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea (PubChem CID 6903322) has the molecular formula C12H16N6S2 and a molecular weight of 308.44 g/mol. Its IUPAC name is 1-methyl-3-[(E)-[3-[(E)-(methylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-methyl-3-[(E)-[3-[(E)-(methylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 6903322 |
| Molecular Formula | C12H16N6S2 |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-methyl-3-[(E)-[3-[(E)-(methylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea |
| SMILES | CNC(=S)N/N=C/c1cccc(/C=N/NC(=S)NC)c1 |
| InChI | InChI=1S/C12H16N6S2/c1-13-11(19)17-15-7-9-4-3-5-10(6-9)8-16-18-12(20)14-2/h3-8H,1-2H3,(H2,13,17,19)(H2,14,18,20)/b15-7+,16-8+ |
| InChIKey | QOQLMCNKIATBLO-BGPOSVGRSA-N |
| XLogP | 0.54 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|