C10H11N3OS — CID 139086841
1-[(E)-(4-formylphenyl)methylideneamino]-3-methylthiourea (PubChem CID 139086841) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is 1-[(E)-(4-formylphenyl)methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-(4-formylphenyl)methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 139086841 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-[(E)-(4-formylphenyl)methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C/c1ccc(C=O)cc1 |
| InChI | InChI=1S/C10H11N3OS/c1-11-10(15)13-12-6-8-2-4-9(7-14)5-3-8/h2-7H,1H3,(H2,11,13,15)/b12-6+ |
| InChIKey | GZBMLZXTILBNAI-WUXMJOGZSA-N |
| XLogP | 0.93 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|