C13H17N5S2 — CID 172956080
N-methyl-2-[[4-[(E)-(methylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]ethanethioamide (PubChem CID 172956080) has the molecular formula C13H17N5S2 and a molecular weight of 307.45 g/mol. Its IUPAC name is N-methyl-2-[[4-[(E)-(methylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]ethanethioamide.
| Compound Name | N-methyl-2-[[4-[(E)-(methylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]ethanethioamide |
|---|---|
| PubChem CID | 172956080 |
| Molecular Formula | C13H17N5S2 |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-methyl-2-[[4-[(E)-(methylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]ethanethioamide |
| SMILES | CNC(=S)C/N=C/c1ccc(/C=N/NC(=S)NC)cc1 |
| InChI | InChI=1S/C13H17N5S2/c1-14-12(19)9-16-7-10-3-5-11(6-4-10)8-17-18-13(20)15-2/h3-8H,9H2,1-2H3,(H,14,19)(H2,15,18,20)/b16-7+,17-8+ |
| InChIKey | UBSFEOYFPXQCGY-GDWCLCACSA-N |
| XLogP | 1.08 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|