C16H14Cl3N3OS — CID 6155707
1-methyl-3-[(Z)-[4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]thiourea (PubChem CID 6155707) has the molecular formula C16H14Cl3N3OS and a molecular weight of 402.73 g/mol. Its IUPAC name is 1-methyl-3-[(Z)-[4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]thiourea.
| Compound Name | 1-methyl-3-[(Z)-[4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 6155707 |
| Molecular Formula | C16H14Cl3N3OS |
| Molecular Weight | 402.73 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 1-methyl-3-[(Z)-[4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]thiourea |
| SMILES | CNC(=S)N/N=C\c1ccc(OCc2c(Cl)ccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl3N3OS/c1-20-16(24)22-21-8-10-2-4-11(5-3-10)23-9-12-13(17)6-7-14(18)15(12)19/h2-8H,9H2,1H3,(H2,20,22,24)/b21-8- |
| InChIKey | ITLOBUXOFQYKIF-WNFQYIGGSA-N |
| XLogP | 4.65 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.73 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|