C16H15Cl3N2O — CID 110339767
N-methyl-N-[(E)-[4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]methanamine (PubChem CID 110339767) has the molecular formula C16H15Cl3N2O and a molecular weight of 357.67 g/mol. Its IUPAC name is N-methyl-N-[(E)-[4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]methanamine.
| Compound Name | N-methyl-N-[(E)-[4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]methanamine |
|---|---|
| PubChem CID | 110339767 |
| Molecular Formula | C16H15Cl3N2O |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | N-methyl-N-[(E)-[4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]methanamine |
| SMILES | CN(C)/N=C/c1ccc(OCc2c(Cl)ccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H15Cl3N2O/c1-21(2)20-9-11-3-5-12(6-4-11)22-10-13-14(17)7-8-15(18)16(13)19/h3-9H,10H2,1-2H3/b20-9+ |
| InChIKey | DGPZVEVCROOLAA-AWQFTUOYSA-N |
| XLogP | 5.12 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|