C16H16Cl2N2O — CID 19059891
1-(2,6-dichlorophenyl)-N-[(E)-(4-ethoxyphenyl)methylideneamino]methanamine (PubChem CID 19059891) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[(E)-(4-ethoxyphenyl)methylideneamino]methanamine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[(E)-(4-ethoxyphenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 19059891 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[(E)-(4-ethoxyphenyl)methylideneamino]methanamine |
| SMILES | CCOc1ccc(/C=N/NCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-2-21-13-8-6-12(7-9-13)10-19-20-11-14-15(17)4-3-5-16(14)18/h3-10,20H,2,11H2,1H3/b19-10+ |
| InChIKey | RBPXDRJGWGPYNB-VXLYETTFSA-N |
| XLogP | 4.52 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|