C15H13BrCl2N2O — CID 19059893
N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-1-(2,6-dichlorophenyl)methanamine (PubChem CID 19059893) has the molecular formula C15H13BrCl2N2O and a molecular weight of 388.09 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-1-(2,6-dichlorophenyl)methanamine.
| Compound Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 19059893 |
| Molecular Formula | C15H13BrCl2N2O |
| Molecular Weight | 388.09 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
| SMILES | COc1ccc(/C=N/NCc2c(Cl)cccc2Cl)cc1Br |
| InChI | InChI=1S/C15H13BrCl2N2O/c1-21-15-6-5-10(7-12(15)16)8-19-20-9-11-13(17)3-2-4-14(11)18/h2-8,20H,9H2,1H3/b19-8+ |
| InChIKey | NEVMCKCYTUDKEH-UFWORHAWSA-N |
| XLogP | 4.89 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.09 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|