About 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline
2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline (PubChem CID 19060061) has the molecular formula C16H16BrCl2N3
and a molecular weight of 401.14 g/mol. Its IUPAC name is 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline |
| PubChem CID | 19060061 |
| Molecular Formula | C16H16BrCl2N3 |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/NCc2c(Cl)cccc2Cl)cc1Br |
| InChI | InChI=1S/C16H16BrCl2N3/c1-22(2)16-7-6-11(8-13(16)17)9-20-21-10-12-14(18)4-3-5-15(12)19/h3-9,21H,10H2,1-2H3/b20-9+ |
| InChIKey | KIQMKLOBYKOACE-AWQFTUOYSA-N |
| XLogP | 4.95 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline?
The IUPAC name of 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline (CID 19060061) is 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline.
What is the SMILES notation for 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline?
The canonical SMILES for 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline is CN(C)c1ccc(/C=N/NCc2c(Cl)cccc2Cl)cc1Br.
What is the InChIKey of 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline?
The InChIKey is KIQMKLOBYKOACE-AWQFTUOYSA-N. The full InChI is InChI=1S/C16H16BrCl2N3/c1-22(2)16-7-6-11(8-13(16)17)9-20-21-10-12-14(18)4-3-5-15(12)19/h3-9,21H,10H2,1-2H3/b20-9+.
What are the key properties of 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline?
2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline has a molecular weight of 401.14 g/mol, XLogP of 4.95, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline is sourced from PubChem (CID 19060061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).