C16H16BrCl2N3 — CID 19060061
2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline (PubChem CID 19060061) has the molecular formula C16H16BrCl2N3 and a molecular weight of 401.14 g/mol. Its IUPAC name is 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline.
| Compound Name | 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 19060061 |
| Molecular Formula | C16H16BrCl2N3 |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 2-bromo-4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/NCc2c(Cl)cccc2Cl)cc1Br |
| InChI | InChI=1S/C16H16BrCl2N3/c1-22(2)16-7-6-11(8-13(16)17)9-20-21-10-12-14(18)4-3-5-15(12)19/h3-9,21H,10H2,1-2H3/b20-9+ |
| InChIKey | KIQMKLOBYKOACE-AWQFTUOYSA-N |
| XLogP | 4.95 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|