C15H14BrCl2N3 — CID 20513013
4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline (PubChem CID 20513013) has the molecular formula C15H14BrCl2N3 and a molecular weight of 387.11 g/mol. Its IUPAC name is 4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline.
| Compound Name | 4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline |
|---|---|
| PubChem CID | 20513013 |
| Molecular Formula | C15H14BrCl2N3 |
| Molecular Weight | 387.11 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | 4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline |
| SMILES | CN(C)c1ccc(/C=N/c2c(Cl)cc(N)cc2Cl)cc1Br |
| InChI | InChI=1S/C15H14BrCl2N3/c1-21(2)14-4-3-9(5-11(14)16)8-20-15-12(17)6-10(19)7-13(15)18/h3-8H,19H2,1-2H3/b20-8+ |
| InChIKey | DLWBRLRUZRXCJO-DNTJNYDQSA-N |
| XLogP | 5.15 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.11 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|