C18H19BrCl2N4 — CID 13064605
N'-[4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide (PubChem CID 13064605) has the molecular formula C18H19BrCl2N4 and a molecular weight of 442.19 g/mol. Its IUPAC name is N'-[4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 13064605 |
| Molecular Formula | C18H19BrCl2N4 |
| Molecular Weight | 442.19 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | N'-[4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2,6-dichlorophenyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1c(Cl)cc(/N=C/c2ccc(N(C)C)c(Br)c2)cc1Cl |
| InChI | InChI=1S/C18H19BrCl2N4/c1-24(2)11-23-18-15(20)8-13(9-16(18)21)22-10-12-5-6-17(25(3)4)14(19)7-12/h5-11H,1-4H3/b22-10+,23-11+ |
| InChIKey | RFRYXNCUGZQNGH-CZGKVYIXSA-N |
| XLogP | 5.79 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.19 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|