C15H13Cl2IN2O2 — CID 136822584
4-[(Z)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-2-iodo-6-methoxyphenol (PubChem CID 136822584) has the molecular formula C15H13Cl2IN2O2 and a molecular weight of 451.09 g/mol. Its IUPAC name is 4-[(Z)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(Z)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 136822584 |
| Molecular Formula | C15H13Cl2IN2O2 |
| Molecular Weight | 451.09 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | 4-[(Z)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-2-iodo-6-methoxyphenol |
| SMILES | COc1cc(/C=N\NCc2c(Cl)cccc2Cl)cc(I)c1O |
| InChI | InChI=1S/C15H13Cl2IN2O2/c1-22-14-6-9(5-13(18)15(14)21)7-19-20-8-10-11(16)3-2-4-12(10)17/h2-7,20-21H,8H2,1H3/b19-7- |
| InChIKey | PCJUVLOZLFDTHW-GXHLCREISA-N |
| XLogP | 4.44 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.09 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|