C17H19IN2O4 — CID 136727524
4-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-iodo-6-methoxyphenol (PubChem CID 136727524) has the molecular formula C17H19IN2O4 and a molecular weight of 442.25 g/mol. Its IUPAC name is 4-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 136727524 |
| Molecular Formula | C17H19IN2O4 |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 4-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-iodo-6-methoxyphenol |
| SMILES | COc1ccc(CN/N=C\c2cc(I)c(O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C17H19IN2O4/c1-22-14-5-4-11(7-15(14)23-2)9-19-20-10-12-6-13(18)17(21)16(8-12)24-3/h4-8,10,19,21H,9H2,1-3H3/b20-10- |
| InChIKey | LGSPYBOAUVPKJK-JMIUGGIZSA-N |
| XLogP | 3.15 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|