C19H22N2O6 — CID 133169157
2-[4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 133169157) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 133169157 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1ccc(CN/N=C/c2ccc(OCC(=O)O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H22N2O6/c1-24-15-6-4-13(8-17(15)25-2)10-20-21-11-14-5-7-16(18(9-14)26-3)27-12-19(22)23/h4-9,11,20H,10,12H2,1-3H3,(H,22,23)/b21-11+ |
| InChIKey | LEHUXNFBDCCFOB-SRZZPIQSSA-N |
| XLogP | 2.30 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|