C20H24N2O5 — CID 133171031
ethyl 2-[4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]phenoxy]acetate (PubChem CID 133171031) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 133171031 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | ethyl 2-[4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=N/NCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H24N2O5/c1-4-26-20(23)14-27-17-8-5-15(6-9-17)12-21-22-13-16-7-10-18(24-2)19(11-16)25-3/h5-12,22H,4,13-14H2,1-3H3/b21-12+ |
| InChIKey | BAKONNWZLXTZNT-CIAFOILYSA-N |
| XLogP | 2.77 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|