C23H27N3O4 — CID 92658314
ethyl 2-[3-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-methylindol-1-yl]acetate (PubChem CID 92658314) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is ethyl 2-[3-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 92658314 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | ethyl 2-[3-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-2-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(/C=N\NCc2ccc(OC)c(OC)c2)c2ccccc21 |
| InChI | InChI=1S/C23H27N3O4/c1-5-30-23(27)15-26-16(2)19(18-8-6-7-9-20(18)26)14-25-24-13-17-10-11-21(28-3)22(12-17)29-4/h6-12,14,24H,5,13,15H2,1-4H3/b25-14- |
| InChIKey | XVZKCHOMLULWRB-QFEZKATASA-N |
| XLogP | 3.65 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|