C25H25N3O6 — CID 165165696
ethyl 2-[3-[(E)-[[6-(hydroxymethyl)-4-methoxy-1-benzofuran-2-carbonyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate (PubChem CID 165165696) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is ethyl 2-[3-[(E)-[[6-(hydroxymethyl)-4-methoxy-1-benzofuran-2-carbonyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(E)-[[6-(hydroxymethyl)-4-methoxy-1-benzofuran-2-carbonyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 165165696 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | ethyl 2-[3-[(E)-[[6-(hydroxymethyl)-4-methoxy-1-benzofuran-2-carbonyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(/C=N/NC(=O)c2cc3c(OC)cc(CO)cc3o2)c2ccccc21 |
| InChI | InChI=1S/C25H25N3O6/c1-4-33-24(30)13-28-15(2)19(17-7-5-6-8-20(17)28)12-26-27-25(31)23-11-18-21(32-3)9-16(14-29)10-22(18)34-23/h5-12,29H,4,13-14H2,1-3H3,(H,27,31)/b26-12+ |
| InChIKey | IXCYDUOVGJUEIY-RPPGKUMJSA-N |
| XLogP | 3.52 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|