C27H30N6O8 — CID 126019046
ethyl 2-[3-[(Z)-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]-4-methylpentanoyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate (PubChem CID 126019046) has the molecular formula C27H30N6O8 and a molecular weight of 566.57 g/mol. Its IUPAC name is ethyl 2-[3-[(Z)-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]-4-methylpentanoyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(Z)-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]-4-methylpentanoyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 126019046 |
| Molecular Formula | C27H30N6O8 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | ethyl 2-[3-[(Z)-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]-4-methylpentanoyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C27H30N6O8/c1-5-41-25(34)15-31-17(4)22(21-8-6-7-9-24(21)31)14-28-30-27(36)23(10-16(2)3)29-26(35)18-11-19(32(37)38)13-20(12-18)33(39)40/h6-9,11-14,16,23H,5,10,15H2,1-4H3,(H,29,35)(H,30,36)/b28-14-/t23-/m0/s1 |
| InChIKey | IEDAKKUUSURQPS-XUAJFUKTSA-N |
| XLogP | 3.62 |
| TPSA | 188.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|