C25H23N5O9 — CID 136738010
N-[(2S)-1-[(2Z)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3,5-dinitrobenzamide (PubChem CID 136738010) has the molecular formula C25H23N5O9 and a molecular weight of 537.49 g/mol. Its IUPAC name is N-[(2S)-1-[(2Z)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[(2S)-1-[(2Z)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 136738010 |
| Molecular Formula | C25H23N5O9 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | N-[(2S)-1-[(2Z)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3,5-dinitrobenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)ccc1O |
| InChI | InChI=1S/C25H23N5O9/c1-2-39-23-10-16(5-8-22(23)32)14-26-28-25(34)21(9-15-3-6-20(31)7-4-15)27-24(33)17-11-18(29(35)36)13-19(12-17)30(37)38/h3-8,10-14,21,31-32H,2,9H2,1H3,(H,27,33)(H,28,34)/b26-14-/t21-/m0/s1 |
| InChIKey | VCZXETSKJBMDDV-IDEIYSCTSA-N |
| XLogP | 2.80 |
| TPSA | 206.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|