C26H25N5O8 — CID 98046625
N-[(2R)-3-(4-hydroxyphenyl)-1-oxo-1-[(2Z)-2-[(4-propoxyphenyl)methylidene]hydrazinyl]propan-2-yl]-3,5-dinitrobenzamide (PubChem CID 98046625) has the molecular formula C26H25N5O8 and a molecular weight of 535.51 g/mol. Its IUPAC name is N-[(2R)-3-(4-hydroxyphenyl)-1-oxo-1-[(2Z)-2-[(4-propoxyphenyl)methylidene]hydrazinyl]propan-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[(2R)-3-(4-hydroxyphenyl)-1-oxo-1-[(2Z)-2-[(4-propoxyphenyl)methylidene]hydrazinyl]propan-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 98046625 |
| Molecular Formula | C26H25N5O8 |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | N-[(2R)-3-(4-hydroxyphenyl)-1-oxo-1-[(2Z)-2-[(4-propoxyphenyl)methylidene]hydrazinyl]propan-2-yl]-3,5-dinitrobenzamide |
| SMILES | CCCOc1ccc(/C=N\NC(=O)[C@@H](Cc2ccc(O)cc2)NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H25N5O8/c1-2-11-39-23-9-5-18(6-10-23)16-27-29-26(34)24(12-17-3-7-22(32)8-4-17)28-25(33)19-13-20(30(35)36)15-21(14-19)31(37)38/h3-10,13-16,24,32H,2,11-12H2,1H3,(H,28,33)(H,29,34)/b27-16-/t24-/m1/s1 |
| InChIKey | FUKGFLVNIJMXIR-YMCFUUGVSA-N |
| XLogP | 3.49 |
| TPSA | 186.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|