C23H23N5O7 — CID 126021143
N-[(2S)-4-methyl-1-oxo-1-[(2Z)-2-[(4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]pentan-2-yl]-3,5-dinitrobenzamide (PubChem CID 126021143) has the molecular formula C23H23N5O7 and a molecular weight of 481.47 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-oxo-1-[(2Z)-2-[(4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]pentan-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[(2S)-4-methyl-1-oxo-1-[(2Z)-2-[(4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]pentan-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 126021143 |
| Molecular Formula | C23H23N5O7 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[(2S)-4-methyl-1-oxo-1-[(2Z)-2-[(4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]pentan-2-yl]-3,5-dinitrobenzamide |
| SMILES | C#CCOc1ccc(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H23N5O7/c1-4-9-35-20-7-5-16(6-8-20)14-24-26-23(30)21(10-15(2)3)25-22(29)17-11-18(27(31)32)13-19(12-17)28(33)34/h1,5-8,11-15,21H,9-10H2,2-3H3,(H,25,29)(H,26,30)/b24-14-/t21-/m0/s1 |
| InChIKey | MXWQKTTZKHBVBV-ZJVWCJDDSA-N |
| XLogP | 2.81 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|