C23H28N4O5 — CID 126016762
(2R)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methyl-N-[(Z)-(3-nitrophenyl)methylideneamino]pentanamide (PubChem CID 126016762) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is (2R)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methyl-N-[(Z)-(3-nitrophenyl)methylideneamino]pentanamide.
| Compound Name | (2R)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methyl-N-[(Z)-(3-nitrophenyl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 126016762 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (2R)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methyl-N-[(Z)-(3-nitrophenyl)methylideneamino]pentanamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@H](CC(C)C)C(=O)N/N=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H28N4O5/c1-15(2)11-20(25-21(28)14-32-22-16(3)7-5-8-17(22)4)23(29)26-24-13-18-9-6-10-19(12-18)27(30)31/h5-10,12-13,15,20H,11,14H2,1-4H3,(H,25,28)(H,26,29)/b24-13-/t20-/m1/s1 |
| InChIKey | ALKJRRKBZGTZNR-GEUHTFEZSA-N |
| XLogP | 3.27 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|