C18H20N4O3 — CID 5410900
(2S)-2-(2,6-dimethylanilino)-N-[(Z)-(3-nitrophenyl)methylideneamino]propanamide (PubChem CID 5410900) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2S)-2-(2,6-dimethylanilino)-N-[(Z)-(3-nitrophenyl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(2,6-dimethylanilino)-N-[(Z)-(3-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 5410900 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2S)-2-(2,6-dimethylanilino)-N-[(Z)-(3-nitrophenyl)methylideneamino]propanamide |
| SMILES | Cc1cccc(C)c1N[C@@H](C)C(=O)N/N=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N4O3/c1-12-6-4-7-13(2)17(12)20-14(3)18(23)21-19-11-15-8-5-9-16(10-15)22(24)25/h4-11,14,20H,1-3H3,(H,21,23)/b19-11-/t14-/m0/s1 |
| InChIKey | PWCAJDKHFCNVCG-KVMVOAJRSA-N |
| XLogP | 3.16 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|