C18H21N3O2 — CID 135850815
(2R)-2-(2,6-dimethylanilino)-N-[(E)-(4-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 135850815) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (2R)-2-(2,6-dimethylanilino)-N-[(E)-(4-hydroxyphenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-(2,6-dimethylanilino)-N-[(E)-(4-hydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135850815 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2R)-2-(2,6-dimethylanilino)-N-[(E)-(4-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | Cc1cccc(C)c1N[C@H](C)C(=O)N/N=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-12-5-4-6-13(2)17(12)20-14(3)18(23)21-19-11-15-7-9-16(22)10-8-15/h4-11,14,20,22H,1-3H3,(H,21,23)/b19-11+/t14-/m1/s1 |
| InChIKey | GXVBLPYMPUGBCN-HIPSJFSSSA-N |
| XLogP | 2.96 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|