C16H15BrN2O3 — CID 135784413
(2R)-2-(3-bromophenoxy)-N-[(E)-(4-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 135784413) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is (2R)-2-(3-bromophenoxy)-N-[(E)-(4-hydroxyphenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-(3-bromophenoxy)-N-[(E)-(4-hydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135784413 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (2R)-2-(3-bromophenoxy)-N-[(E)-(4-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | C[C@@H](Oc1cccc(Br)c1)C(=O)N/N=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C16H15BrN2O3/c1-11(22-15-4-2-3-13(17)9-15)16(21)19-18-10-12-5-7-14(20)8-6-12/h2-11,20H,1H3,(H,19,21)/b18-10+/t11-/m1/s1 |
| InChIKey | IQFIWIQEYLEYTO-VDCVXVNISA-N |
| XLogP | 3.07 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|