C14H15BrN4O2 — CID 3791955
2-(3-bromophenoxy)-N-[(1-methylpyrazol-4-yl)methylideneamino]propanamide (PubChem CID 3791955) has the molecular formula C14H15BrN4O2 and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N-[(1-methylpyrazol-4-yl)methylideneamino]propanamide.
| Compound Name | 2-(3-bromophenoxy)-N-[(1-methylpyrazol-4-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 3791955 |
| Molecular Formula | C14H15BrN4O2 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 2-(3-bromophenoxy)-N-[(1-methylpyrazol-4-yl)methylideneamino]propanamide |
| SMILES | CC(Oc1cccc(Br)c1)C(=O)NN=Cc1cnn(C)c1 |
| InChI | InChI=1S/C14H15BrN4O2/c1-10(21-13-5-3-4-12(15)6-13)14(20)18-16-7-11-8-17-19(2)9-11/h3-10H,1-2H3,(H,18,20) |
| InChIKey | YRHBGASQYBJVPF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|