C35H39N3O5 — CID 126019114
(2S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-N-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-methylpentanamide (PubChem CID 126019114) has the molecular formula C35H39N3O5 and a molecular weight of 581.71 g/mol. Its IUPAC name is (2S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-N-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-N-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126019114 |
| Molecular Formula | C35H39N3O5 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | (2S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-N-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-methylpentanamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)COc2c(C)cccc2C)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C35H39N3O5/c1-23(2)18-30(37-33(39)22-43-34-24(3)10-8-11-25(34)4)35(40)38-36-20-26-16-17-31(32(19-26)41-5)42-21-28-14-9-13-27-12-6-7-15-29(27)28/h6-17,19-20,23,30H,18,21-22H2,1-5H3,(H,37,39)(H,38,40)/b36-20-/t30-/m0/s1 |
| InChIKey | IOUOERIIYHBNLV-YPAGLRGZSA-N |
| XLogP | 6.10 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|