C26H23N5O8S — CID 92905462
methyl 4-[(Z)-[[(2S)-3-benzylsulfanyl-2-[(3,5-dinitrobenzoyl)amino]propanoyl]hydrazinylidene]methyl]benzoate (PubChem CID 92905462) has the molecular formula C26H23N5O8S and a molecular weight of 565.56 g/mol. Its IUPAC name is methyl 4-[(Z)-[[(2S)-3-benzylsulfanyl-2-[(3,5-dinitrobenzoyl)amino]propanoyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[[(2S)-3-benzylsulfanyl-2-[(3,5-dinitrobenzoyl)amino]propanoyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 92905462 |
| Molecular Formula | C26H23N5O8S |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | methyl 4-[(Z)-[[(2S)-3-benzylsulfanyl-2-[(3,5-dinitrobenzoyl)amino]propanoyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N\NC(=O)[C@@H](CSCc2ccccc2)NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H23N5O8S/c1-39-26(34)19-9-7-17(8-10-19)14-27-29-25(33)23(16-40-15-18-5-3-2-4-6-18)28-24(32)20-11-21(30(35)36)13-22(12-20)31(37)38/h2-14,23H,15-16H2,1H3,(H,28,32)(H,29,33)/b27-14-/t23-/m1/s1 |
| InChIKey | FRUGKGBXDKPKLQ-YZYFAYFQSA-N |
| XLogP | 3.47 |
| TPSA | 183.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|