C24H19Cl2N5O6S — CID 4067915
N-[3-benzylsulfanyl-1-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-3,5-dinitrobenzamide (PubChem CID 4067915) has the molecular formula C24H19Cl2N5O6S and a molecular weight of 576.42 g/mol. Its IUPAC name is N-[3-benzylsulfanyl-1-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[3-benzylsulfanyl-1-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4067915 |
| Molecular Formula | C24H19Cl2N5O6S |
| Molecular Weight | 576.42 g/mol |
| Exact Mass | 575.04 |
| IUPAC Name | N-[3-benzylsulfanyl-1-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-3,5-dinitrobenzamide |
| SMILES | O=C(NC(CSCc1ccccc1)C(=O)NN=Cc1ccc(Cl)cc1Cl)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H19Cl2N5O6S/c25-18-7-6-16(21(26)10-18)12-27-29-24(33)22(14-38-13-15-4-2-1-3-5-15)28-23(32)17-8-19(30(34)35)11-20(9-17)31(36)37/h1-12,22H,13-14H2,(H,28,32)(H,29,33) |
| InChIKey | VNBNKYHYQKNGBJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|