C31H28BrN3O3S — CID 171978962
N-[3-benzylsulfanyl-1-oxo-1-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]propan-2-yl]-2-bromobenzamide (PubChem CID 171978962) has the molecular formula C31H28BrN3O3S and a molecular weight of 602.55 g/mol. Its IUPAC name is N-[3-benzylsulfanyl-1-oxo-1-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]propan-2-yl]-2-bromobenzamide.
| Compound Name | N-[3-benzylsulfanyl-1-oxo-1-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]propan-2-yl]-2-bromobenzamide |
|---|---|
| PubChem CID | 171978962 |
| Molecular Formula | C31H28BrN3O3S |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 601.10 |
| IUPAC Name | N-[3-benzylsulfanyl-1-oxo-1-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]propan-2-yl]-2-bromobenzamide |
| SMILES | O=C(NC(CSCc1ccccc1)C(=O)N/N=C/c1ccccc1OCc1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C31H28BrN3O3S/c32-27-17-9-8-16-26(27)30(36)34-28(22-39-21-24-13-5-2-6-14-24)31(37)35-33-19-25-15-7-10-18-29(25)38-20-23-11-3-1-4-12-23/h1-19,28H,20-22H2,(H,34,36)(H,35,37)/b33-19+ |
| InChIKey | DBFAVELTEKDHAL-HNSNBQBZSA-N |
| XLogP | 6.21 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|