C26H26BrN3O2S — CID 46501155
N-[3-benzylsulfanyl-1-[(2E)-2-[1-(4-methylphenyl)ethylidene]hydrazinyl]-1-oxopropan-2-yl]-2-bromobenzamide (PubChem CID 46501155) has the molecular formula C26H26BrN3O2S and a molecular weight of 524.48 g/mol. Its IUPAC name is N-[3-benzylsulfanyl-1-[(2E)-2-[1-(4-methylphenyl)ethylidene]hydrazinyl]-1-oxopropan-2-yl]-2-bromobenzamide.
| Compound Name | N-[3-benzylsulfanyl-1-[(2E)-2-[1-(4-methylphenyl)ethylidene]hydrazinyl]-1-oxopropan-2-yl]-2-bromobenzamide |
|---|---|
| PubChem CID | 46501155 |
| Molecular Formula | C26H26BrN3O2S |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | N-[3-benzylsulfanyl-1-[(2E)-2-[1-(4-methylphenyl)ethylidene]hydrazinyl]-1-oxopropan-2-yl]-2-bromobenzamide |
| SMILES | C/C(=N\NC(=O)C(CSCc1ccccc1)NC(=O)c1ccccc1Br)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H26BrN3O2S/c1-18-12-14-21(15-13-18)19(2)29-30-26(32)24(17-33-16-20-8-4-3-5-9-20)28-25(31)22-10-6-7-11-23(22)27/h3-15,24H,16-17H2,1-2H3,(H,28,31)(H,30,32)/b29-19+ |
| InChIKey | XXMBKJIGVPJHAN-VUTHCHCSSA-N |
| XLogP | 5.33 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|