C23H28BrN3O2S — CID 171979203
N-[3-benzylsulfanyl-1-[(2E)-2-(3-methylpentan-2-ylidene)hydrazinyl]-1-oxopropan-2-yl]-2-bromobenzamide (PubChem CID 171979203) has the molecular formula C23H28BrN3O2S and a molecular weight of 490.47 g/mol. Its IUPAC name is N-[3-benzylsulfanyl-1-[(2E)-2-(3-methylpentan-2-ylidene)hydrazinyl]-1-oxopropan-2-yl]-2-bromobenzamide.
| Compound Name | N-[3-benzylsulfanyl-1-[(2E)-2-(3-methylpentan-2-ylidene)hydrazinyl]-1-oxopropan-2-yl]-2-bromobenzamide |
|---|---|
| PubChem CID | 171979203 |
| Molecular Formula | C23H28BrN3O2S |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N-[3-benzylsulfanyl-1-[(2E)-2-(3-methylpentan-2-ylidene)hydrazinyl]-1-oxopropan-2-yl]-2-bromobenzamide |
| SMILES | CCC(C)/C(C)=N/NC(=O)C(CSCc1ccccc1)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C23H28BrN3O2S/c1-4-16(2)17(3)26-27-23(29)21(15-30-14-18-10-6-5-7-11-18)25-22(28)19-12-8-9-13-20(19)24/h5-13,16,21H,4,14-15H2,1-3H3,(H,25,28)(H,27,29)/b26-17+ |
| InChIKey | KISKWNQHVIXOJD-YZSQISJMSA-N |
| XLogP | 5.02 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|