C19H28N4O5S — CID 10365040
ethyl (2Z)-2-amino-2-[[(2R)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]hydrazinylidene]acetate (PubChem CID 10365040) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is ethyl (2Z)-2-amino-2-[[(2R)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]hydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-amino-2-[[(2R)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 10365040 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | ethyl (2Z)-2-amino-2-[[(2R)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(N)=N/NC(=O)[C@H](CSCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N4O5S/c1-5-27-17(25)15(20)22-23-16(24)14(21-18(26)28-19(2,3)4)12-29-11-13-9-7-6-8-10-13/h6-10,14H,5,11-12H2,1-4H3,(H2,20,22)(H,21,26)(H,23,24)/t14-/m0/s1 |
| InChIKey | CRAZRRABSODAAA-AWEZNQCLSA-N |
| XLogP | 1.76 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|