C24H33N4O4S+ — CID 143389507
[2-[4-(aminomethyl)phenyl]acetyl]-[[(2S)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]azanium (PubChem CID 143389507) has the molecular formula C24H33N4O4S+ and a molecular weight of 473.62 g/mol. Its IUPAC name is [2-[4-(aminomethyl)phenyl]acetyl]-[[(2S)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]azanium.
| Compound Name | [2-[4-(aminomethyl)phenyl]acetyl]-[[(2S)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]azanium |
|---|---|
| PubChem CID | 143389507 |
| Molecular Formula | C24H33N4O4S+ |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | [2-[4-(aminomethyl)phenyl]acetyl]-[[(2S)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]azanium |
| SMILES | CC(C)(C)OC(=O)N[C@H](CSCc1ccccc1)C(=O)N[NH2+]C(=O)Cc1ccc(CN)cc1 |
| InChI | InChI=1S/C24H32N4O4S/c1-24(2,3)32-23(31)26-20(16-33-15-19-7-5-4-6-8-19)22(30)28-27-21(29)13-17-9-11-18(14-25)12-10-17/h4-12,20H,13-16,25H2,1-3H3,(H,26,31)(H,27,29)(H,28,30)/p+1/t20-/m1/s1 |
| InChIKey | LTFBMUUWEGUPPD-HXUWFJFHSA-O |
| XLogP | 1.64 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|