C23H30N4O4 — CID 58794955
tert-butyl N-[(2R)-1-[2-[4-(aminomethyl)benzoyl]hydrazinyl]-1-oxo-4-phenylbutan-2-yl]carbamate (PubChem CID 58794955) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[2-[4-(aminomethyl)benzoyl]hydrazinyl]-1-oxo-4-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[2-[4-(aminomethyl)benzoyl]hydrazinyl]-1-oxo-4-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58794955 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tert-butyl N-[(2R)-1-[2-[4-(aminomethyl)benzoyl]hydrazinyl]-1-oxo-4-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCc1ccccc1)C(=O)NNC(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C23H30N4O4/c1-23(2,3)31-22(30)25-19(14-11-16-7-5-4-6-8-16)21(29)27-26-20(28)18-12-9-17(15-24)10-13-18/h4-10,12-13,19H,11,14-15,24H2,1-3H3,(H,25,30)(H,26,28)(H,27,29)/t19-/m1/s1 |
| InChIKey | BZZAJQILEFBTSG-LJQANCHMSA-N |
| XLogP | 2.43 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|