C20H31NO4 — CID 118638342
2-methylbutan-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate (PubChem CID 118638342) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is 2-methylbutan-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate.
| Compound Name | 2-methylbutan-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 118638342 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 2-methylbutan-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate |
| SMILES | CCC(C)(C)OC(=O)[C@H](CCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31NO4/c1-7-20(5,6)24-17(22)16(21-18(23)25-19(2,3)4)14-13-15-11-9-8-10-12-15/h8-12,16H,7,13-14H2,1-6H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | UTMGGCOBMYPKOR-INIZCTEOSA-N |
| XLogP | 4.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |