C23H28N2O7 — CID 59287481
[4-(nitrooxymethyl)phenyl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate (PubChem CID 59287481) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is [4-(nitrooxymethyl)phenyl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate.
| Compound Name | [4-(nitrooxymethyl)phenyl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 59287481 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [4-(nitrooxymethyl)phenyl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)NC(CCc1ccccc1)C(=O)OCc1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H28N2O7/c1-23(2,3)32-22(27)24-20(14-13-17-7-5-4-6-8-17)21(26)30-15-18-9-11-19(12-10-18)16-31-25(28)29/h4-12,20H,13-16H2,1-3H3,(H,24,27) |
| InChIKey | OEZANVDRVOEXBK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|