C13H20BrNO2S — CID 86747285
ethyl (2R)-3-benzylsulfanyl-2-(methylamino)propanoate;hydrobromide (PubChem CID 86747285) has the molecular formula C13H20BrNO2S and a molecular weight of 334.28 g/mol. Its IUPAC name is ethyl (2R)-3-benzylsulfanyl-2-(methylamino)propanoate;hydrobromide.
| Compound Name | ethyl (2R)-3-benzylsulfanyl-2-(methylamino)propanoate;hydrobromide |
|---|---|
| PubChem CID | 86747285 |
| Molecular Formula | C13H20BrNO2S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | ethyl (2R)-3-benzylsulfanyl-2-(methylamino)propanoate;hydrobromide |
| SMILES | Br.CCOC(=O)[C@H](CSCc1ccccc1)NC |
| InChI | InChI=1S/C13H19NO2S.BrH/c1-3-16-13(15)12(14-2)10-17-9-11-7-5-4-6-8-11;/h4-8,12,14H,3,9-10H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | GFPMRYMZQXHWHC-YDALLXLXSA-N |
| XLogP | 2.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |