C23H34N2O4S2 — CID 87515368
ethyl (2R)-2-[[2-[[(2S)-2-acetyl-3-methylbutanethioyl]amino]-2-methylpropanoyl]amino]-3-benzylsulfanylpropanoate (PubChem CID 87515368) has the molecular formula C23H34N2O4S2 and a molecular weight of 466.67 g/mol. Its IUPAC name is ethyl (2R)-2-[[2-[[(2S)-2-acetyl-3-methylbutanethioyl]amino]-2-methylpropanoyl]amino]-3-benzylsulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[[2-[[(2S)-2-acetyl-3-methylbutanethioyl]amino]-2-methylpropanoyl]amino]-3-benzylsulfanylpropanoate |
|---|---|
| PubChem CID | 87515368 |
| Molecular Formula | C23H34N2O4S2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | ethyl (2R)-2-[[2-[[(2S)-2-acetyl-3-methylbutanethioyl]amino]-2-methylpropanoyl]amino]-3-benzylsulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CSCc1ccccc1)NC(=O)C(C)(C)NC(=S)[C@H](C(C)=O)C(C)C |
| InChI | InChI=1S/C23H34N2O4S2/c1-7-29-21(27)18(14-31-13-17-11-9-8-10-12-17)24-22(28)23(5,6)25-20(30)19(15(2)3)16(4)26/h8-12,15,18-19H,7,13-14H2,1-6H3,(H,24,28)(H,25,30)/t18-,19-/m0/s1 |
| InChIKey | IVDIUZOEKHQYCF-OALUTQOASA-N |
| XLogP | 3.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|