C21H31BrN2O5 — CID 23519207
ethyl 2-[[2-[(2-bromo-3-methylbutanoyl)amino]-2-methylpropanoyl]amino]-3-phenylmethoxypropanoate (PubChem CID 23519207) has the molecular formula C21H31BrN2O5 and a molecular weight of 471.39 g/mol. Its IUPAC name is ethyl 2-[[2-[(2-bromo-3-methylbutanoyl)amino]-2-methylpropanoyl]amino]-3-phenylmethoxypropanoate.
| Compound Name | ethyl 2-[[2-[(2-bromo-3-methylbutanoyl)amino]-2-methylpropanoyl]amino]-3-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 23519207 |
| Molecular Formula | C21H31BrN2O5 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | ethyl 2-[[2-[(2-bromo-3-methylbutanoyl)amino]-2-methylpropanoyl]amino]-3-phenylmethoxypropanoate |
| SMILES | CCOC(=O)C(COCc1ccccc1)NC(=O)C(C)(C)NC(=O)C(Br)C(C)C |
| InChI | InChI=1S/C21H31BrN2O5/c1-6-29-19(26)16(13-28-12-15-10-8-7-9-11-15)23-20(27)21(4,5)24-18(25)17(22)14(2)3/h7-11,14,16-17H,6,12-13H2,1-5H3,(H,23,27)(H,24,25) |
| InChIKey | VSLMVTGJYFCTGB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|