C25H40N2O6S — CID 89020309
ethyl (2S)-2-[[2-[[(2S)-2-acetylsulfanyl-1-hydroxy-3-methylbutyl]amino]-2-ethylbutanoyl]amino]-3-phenylmethoxypropanoate (PubChem CID 89020309) has the molecular formula C25H40N2O6S and a molecular weight of 496.67 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-[[(2S)-2-acetylsulfanyl-1-hydroxy-3-methylbutyl]amino]-2-ethylbutanoyl]amino]-3-phenylmethoxypropanoate.
| Compound Name | ethyl (2S)-2-[[2-[[(2S)-2-acetylsulfanyl-1-hydroxy-3-methylbutyl]amino]-2-ethylbutanoyl]amino]-3-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 89020309 |
| Molecular Formula | C25H40N2O6S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | ethyl (2S)-2-[[2-[[(2S)-2-acetylsulfanyl-1-hydroxy-3-methylbutyl]amino]-2-ethylbutanoyl]amino]-3-phenylmethoxypropanoate |
| SMILES | CCOC(=O)[C@H](COCc1ccccc1)NC(=O)C(CC)(CC)NC(O)[C@@H](SC(C)=O)C(C)C |
| InChI | InChI=1S/C25H40N2O6S/c1-7-25(8-2,27-22(29)21(17(4)5)34-18(6)28)24(31)26-20(23(30)33-9-3)16-32-15-19-13-11-10-12-14-19/h10-14,17,20-22,27,29H,7-9,15-16H2,1-6H3,(H,26,31)/t20-,21-,22?/m0/s1 |
| InChIKey | SXCWQZQKJKCHLB-LGTSYYJHSA-N |
| XLogP | 3.02 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|