C19H22O4 — CID 100958275
ethyl (2R,3R)-3-hydroxy-2-phenyl-4-phenylmethoxybutanoate (PubChem CID 100958275) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is ethyl (2R,3R)-3-hydroxy-2-phenyl-4-phenylmethoxybutanoate.
| Compound Name | ethyl (2R,3R)-3-hydroxy-2-phenyl-4-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 100958275 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | ethyl (2R,3R)-3-hydroxy-2-phenyl-4-phenylmethoxybutanoate |
| SMILES | CCOC(=O)[C@H](c1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C19H22O4/c1-2-23-19(21)18(16-11-7-4-8-12-16)17(20)14-22-13-15-9-5-3-6-10-15/h3-12,17-18,20H,2,13-14H2,1H3/t17-,18+/m0/s1 |
| InChIKey | HZZSNRMTIZKCBW-ZWKOTPCHSA-N |
| XLogP | 2.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |