C18H23NO3 — CID 10881156
(2R,3S)-3-amino-1,4-bis(phenylmethoxy)butan-2-ol (PubChem CID 10881156) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (2R,3S)-3-amino-1,4-bis(phenylmethoxy)butan-2-ol.
| Compound Name | (2R,3S)-3-amino-1,4-bis(phenylmethoxy)butan-2-ol |
|---|---|
| PubChem CID | 10881156 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (2R,3S)-3-amino-1,4-bis(phenylmethoxy)butan-2-ol |
| SMILES | N[C@@H](COCc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C18H23NO3/c19-17(13-21-11-15-7-3-1-4-8-15)18(20)14-22-12-16-9-5-2-6-10-16/h1-10,17-18,20H,11-14,19H2/t17-,18-/m0/s1 |
| InChIKey | QUVPMQXCZFQGEX-ROUUACIJSA-N |
| XLogP | 2.11 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |