C12H17NO6 — CID 46735900
1-amino-3-phenylmethoxypropan-2-ol;oxalic acid (PubChem CID 46735900) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is 1-amino-3-phenylmethoxypropan-2-ol;oxalic acid.
| Compound Name | 1-amino-3-phenylmethoxypropan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 46735900 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-amino-3-phenylmethoxypropan-2-ol;oxalic acid |
| SMILES | NCC(O)COCc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H15NO2.C2H2O4/c11-6-10(12)8-13-7-9-4-2-1-3-5-9;3-1(4)2(5)6/h1-5,10,12H,6-8,11H2;(H,3,4)(H,5,6) |
| InChIKey | VMYJENYXURSTEP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|