C9H12O3 — CID 59866645
2-phenylmethoxyethane-1,1-diol (PubChem CID 59866645) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-phenylmethoxyethane-1,1-diol.
| Compound Name | 2-phenylmethoxyethane-1,1-diol |
|---|---|
| PubChem CID | 59866645 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-phenylmethoxyethane-1,1-diol |
| SMILES | OC(O)COCc1ccccc1 |
| InChI | InChI=1S/C9H12O3/c10-9(11)7-12-6-8-4-2-1-3-5-8/h1-5,9-11H,6-7H2 |
| InChIKey | NBBMOZIKEXAQGC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|