C18H21BrO3 — CID 101083353
(2S,3S)-3-bromo-1,4-bis(phenylmethoxy)butan-2-ol (PubChem CID 101083353) has the molecular formula C18H21BrO3 and a molecular weight of 365.27 g/mol. Its IUPAC name is (2S,3S)-3-bromo-1,4-bis(phenylmethoxy)butan-2-ol.
| Compound Name | (2S,3S)-3-bromo-1,4-bis(phenylmethoxy)butan-2-ol |
|---|---|
| PubChem CID | 101083353 |
| Molecular Formula | C18H21BrO3 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (2S,3S)-3-bromo-1,4-bis(phenylmethoxy)butan-2-ol |
| SMILES | O[C@@H](COCc1ccccc1)[C@@H](Br)COCc1ccccc1 |
| InChI | InChI=1S/C18H21BrO3/c19-17(13-21-11-15-7-3-1-4-8-15)18(20)14-22-12-16-9-5-2-6-10-16/h1-10,17-18,20H,11-14H2/t17-,18-/m0/s1 |
| InChIKey | VLVDANVVZCYVCU-ROUUACIJSA-N |
| XLogP | 3.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|