C11H15BrO3 — CID 101113557
(2S,3R)-3-bromo-4-phenylmethoxybutane-1,2-diol (PubChem CID 101113557) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is (2S,3R)-3-bromo-4-phenylmethoxybutane-1,2-diol.
| Compound Name | (2S,3R)-3-bromo-4-phenylmethoxybutane-1,2-diol |
|---|---|
| PubChem CID | 101113557 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | (2S,3R)-3-bromo-4-phenylmethoxybutane-1,2-diol |
| SMILES | OC[C@H](O)[C@H](Br)COCc1ccccc1 |
| InChI | InChI=1S/C11H15BrO3/c12-10(11(14)6-13)8-15-7-9-4-2-1-3-5-9/h1-5,10-11,13-14H,6-8H2/t10-,11+/m1/s1 |
| InChIKey | RGYDEEPXYJTXSU-MNOVXSKESA-N |
| XLogP | 1.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|