C12H18O4Se — CID 154270817
(2R,3S,4R)-5-phenylmethoxy-2-selanylpentane-1,3,4-triol (PubChem CID 154270817) has the molecular formula C12H18O4Se and a molecular weight of 305.23 g/mol. Its IUPAC name is (2R,3S,4R)-5-phenylmethoxy-2-selanylpentane-1,3,4-triol.
| Compound Name | (2R,3S,4R)-5-phenylmethoxy-2-selanylpentane-1,3,4-triol |
|---|---|
| PubChem CID | 154270817 |
| Molecular Formula | C12H18O4Se |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (2R,3S,4R)-5-phenylmethoxy-2-selanylpentane-1,3,4-triol |
| SMILES | OC[C@@H]([SeH])[C@@H](O)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C12H18O4Se/c13-6-11(17)12(15)10(14)8-16-7-9-4-2-1-3-5-9/h1-5,10-15,17H,6-8H2/t10-,11-,12+/m1/s1 |
| InChIKey | ZGFADCVDKWUSPR-UTUOFQBUSA-N |
| XLogP | -0.39 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|