C20H26O6 — CID 10713667
(2R,3R,4R,5R)-1,6-bis(phenylmethoxy)hexane-2,3,4,5-tetrol (PubChem CID 10713667) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1,6-bis(phenylmethoxy)hexane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5R)-1,6-bis(phenylmethoxy)hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 10713667 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (2R,3R,4R,5R)-1,6-bis(phenylmethoxy)hexane-2,3,4,5-tetrol |
| SMILES | O[C@@H]([C@H](O)[C@H](O)COCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C20H26O6/c21-17(13-25-11-15-7-3-1-4-8-15)19(23)20(24)18(22)14-26-12-16-9-5-2-6-10-16/h1-10,17-24H,11-14H2/t17-,18-,19-,20-/m1/s1 |
| InChIKey | LMZLWUYNLQAQHZ-UAFMIMERSA-N |
| XLogP | 0.86 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |