C19H26O4Si — CID 134901122
(1R,2R,3R)-1-[dimethyl(phenyl)silyl]-4-phenylmethoxybutane-1,2,3-triol (PubChem CID 134901122) has the molecular formula C19H26O4Si and a molecular weight of 346.50 g/mol. Its IUPAC name is (1R,2R,3R)-1-[dimethyl(phenyl)silyl]-4-phenylmethoxybutane-1,2,3-triol.
| Compound Name | (1R,2R,3R)-1-[dimethyl(phenyl)silyl]-4-phenylmethoxybutane-1,2,3-triol |
|---|---|
| PubChem CID | 134901122 |
| Molecular Formula | C19H26O4Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (1R,2R,3R)-1-[dimethyl(phenyl)silyl]-4-phenylmethoxybutane-1,2,3-triol |
| SMILES | C[Si](C)(c1ccccc1)[C@@H](O)[C@H](O)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C19H26O4Si/c1-24(2,16-11-7-4-8-12-16)19(22)18(21)17(20)14-23-13-15-9-5-3-6-10-15/h3-12,17-22H,13-14H2,1-2H3/t17-,18-,19-/m1/s1 |
| InChIKey | XMVUTFIVKBZVMY-GUDVDZBRSA-N |
| XLogP | 1.44 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|